What is the molecular formula of 2,3-Dimethylanisole?
The molecular formula of 2,3-Dimethylanisole is C9H12O.
What is the molecular weight of 2,3-Dimethylanisole?
The molecular weight of 2,3-Dimethylanisole is 136.19 g/mol.
What is the IUPAC name of 2,3-Dimethylanisole?
The IUPAC name of 2,3-Dimethylanisole is 1-methoxy-2,3-dimethylbenzene.
What is the InChI of 2,3-Dimethylanisole?
The InChI of 2,3-Dimethylanisole is InChI=1S/C9H12O/c1-7-5-4-6-9(10-3)8(7)2/h4-6H,1-3H3.
What is the canonical SMILES of 2,3-Dimethylanisole?
The canonical SMILES of 2,3-Dimethylanisole is CC1=C(C(=CC=C1)OC)C.
What is the CAS number of 2,3-Dimethylanisole?
The CAS number of 2,3-Dimethylanisole is 2944-49-2.
What is the European Community (EC) number of 2,3-Dimethylanisole?
The European Community (EC) number of 2,3-Dimethylanisole is 220-948-0.
What is the UNII of 2,3-Dimethylanisole?
The UNII of 2,3-Dimethylanisole is 1O9C26L62B.
What is the Nikkaji Number of 2,3-Dimethylanisole?
The Nikkaji Number of 2,3-Dimethylanisole is J149.886J.
Is 2,3-Dimethylanisole a canonicalized compound?
Yes, 2,3-Dimethylanisole is a canonicalized compound.