What is the molecular formula of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The molecular formula of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is C12H17BF2O3.
When was 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid created?
2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid was created on July 19, 2005.
What is the IUPAC name of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The IUPAC name of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is (2,3-difluoro-4-hexoxyphenyl)boronic acid.
What is the InChI of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The InChI of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is InChI=1S/C12H17BF2O3/c1-2-3-4-5-8-18-10-7-6-9(13(16)17)11(14)12(10)15/h6-7,16-17H,2-5,8H2,1H3.
What is the InChIKey of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The InChIKey of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is RCHOIHOUIPPIJY-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The canonical SMILES of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is B(C1=C(C(=C(C=C1)OCCCCCC)F)F)(O)O.
How much is the molecular weight of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid?
The molecular weight of 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid is 258.07 g/mol.
How many hydrogen bond donor counts does 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid have?
2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid have?
2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid has 5 hydrogen bond acceptor counts.
How many rotatable bond counts does 2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid have?
2,3-Difluoro-4-(n-hexyloxy)phenylboronic acid has 7 rotatable bond counts.
※ Please kindly note that our products are for research use only.