What is the PubChem CID of 2,3-dibromopropene?
The PubChem CID of 2,3-dibromopropene is 10552.
What is the molecular formula of 2,3-dibromopropene?
The molecular formula of 2,3-dibromopropene is C3H4Br2.
What is the molecular weight of 2,3-dibromopropene?
The molecular weight of 2,3-dibromopropene is 199.87 g/mol.
What is the IUPAC name of 2,3-dibromopropene?
The IUPAC name of 2,3-dibromopropene is 2,3-dibromoprop-1-ene.
What is the InChI of 2,3-dibromopropene?
The InChI of 2,3-dibromopropene is InChI=1S/C3H4Br2/c1-3(5)2-4/h1-2H2.
What is the InChIKey of 2,3-dibromopropene?
The InChIKey of 2,3-dibromopropene is YMFWYDYJHRGGPF-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3-dibromopropene?
The canonical SMILES of 2,3-dibromopropene is C=C(CBr)Br.
What is the CAS number of 2,3-dibromopropene?
The CAS number of 2,3-dibromopropene is 513-31-5.
How many hydrogen bond donor counts does 2,3-dibromopropene have?
2,3-dibromopropene has 0 hydrogen bond donor counts.
How many rotatable bond counts does 2,3-dibromopropene have?
2,3-dibromopropene has 1 rotatable bond count.