What is the molecular formula of 2,3,4,5,6-Pentafluorobenzyl bromide?
The molecular formula of 2,3,4,5,6-Pentafluorobenzyl bromide is C7H2BrF5.
What is the molecular weight of 2,3,4,5,6-Pentafluorobenzyl bromide?
The molecular weight of 2,3,4,5,6-Pentafluorobenzyl bromide is 260.99 g/mol.
What is the IUPAC name of 2,3,4,5,6-Pentafluorobenzyl bromide?
The IUPAC name of 2,3,4,5,6-Pentafluorobenzyl bromide is 1-(bromomethyl)-2,3,4,5,6-pentafluorobenzene.
What is the InChI of 2,3,4,5,6-Pentafluorobenzyl bromide?
The InChI of 2,3,4,5,6-Pentafluorobenzyl bromide is InChI=1S/C7H2BrF5/c8-1-2-3(9)5(11)7(13)6(12)4(2)10/h1H2.
What is the InChIKey of 2,3,4,5,6-Pentafluorobenzyl bromide?
The InChIKey of 2,3,4,5,6-Pentafluorobenzyl bromide is XDEPVFFKOVDUNO-UHFFFAOYSA-N.
What is the canonical SMILES of 2,3,4,5,6-Pentafluorobenzyl bromide?
The canonical SMILES of 2,3,4,5,6-Pentafluorobenzyl bromide is C(C1=C(C(=C(C(=C1F)F)F)F)F)Br.
What is the CAS number of 2,3,4,5,6-Pentafluorobenzyl bromide?
The CAS number of 2,3,4,5,6-Pentafluorobenzyl bromide is 1765-40-8.
What is the European Community (EC) Number of 2,3,4,5,6-Pentafluorobenzyl bromide?
The European Community (EC) Number of 2,3,4,5,6-Pentafluorobenzyl bromide is 217-182-4.
What is the UNII of 2,3,4,5,6-Pentafluorobenzyl bromide?
The UNII of 2,3,4,5,6-Pentafluorobenzyl bromide is V5VL554GFP.
What is the molecular weight of 2,3,4,5,6-Pentafluorobenzyl bromide according to PubChem?
The molecular weight of 2,3,4,5,6-Pentafluorobenzyl bromide is 260.99 g/mol according to PubChem.