What is the PubChem CID of 2,2-Dipicolylamine?
The PubChem CID of 2,2-Dipicolylamine is 73759.
What is the molecular formula of 2,2-Dipicolylamine?
The molecular formula of 2,2-Dipicolylamine is C12H13N3.
What is the molecular weight of 2,2-Dipicolylamine?
The molecular weight of 2,2-Dipicolylamine is 199.25 g/mol.
What is the IUPAC name of 2,2-Dipicolylamine?
The IUPAC name of 2,2-Dipicolylamine is 1-pyridin-2-yl-N-(pyridin-2-ylmethyl)methanamine.
What is the InChI of 2,2-Dipicolylamine?
The InChI of 2,2-Dipicolylamine is InChI=1S/C12H13N3/c1-3-7-14-11(5-1)9-13-10-12-6-2-4-8-15-12/h1-8,13H,9-10H2.
What is the InChIKey of 2,2-Dipicolylamine?
The InChIKey of 2,2-Dipicolylamine is KXZQYLBVMZGIKC-UHFFFAOYSA-N.
What is the canonical SMILES of 2,2-Dipicolylamine?
The canonical SMILES of 2,2-Dipicolylamine is C1=CC=NC(=C1)CNCC2=CC=CC=N2.
What is the CAS number of 2,2-Dipicolylamine?
The CAS number of 2,2-Dipicolylamine is 1539-42-0.
What is the Hydrogen Bond Donor Count of 2,2-Dipicolylamine?
The Hydrogen Bond Donor Count of 2,2-Dipicolylamine is 1.
What is the Rotatable Bond Count of 2,2-Dipicolylamine?
The Rotatable Bond Count of 2,2-Dipicolylamine is 4.