What is the molecular formula of 16-Dehydropregnenolone acetate?
The molecular formula of 16-Dehydropregnenolone acetate is C23H32O3.
What is the molecular weight of 16-Dehydropregnenolone acetate?
The molecular weight of 16-Dehydropregnenolone acetate is 356.5 g/mol.
What is the IUPAC name of 16-Dehydropregnenolone acetate?
The IUPAC name of 16-Dehydropregnenolone acetate is [(3S,8R,9S,10R,13S,14S)-17-acetyl-10,13-dimethyl-2,3,4,7,8,9,11,12,14,15-decahydro-1H-cyclopenta[a]phenanthren-3-yl] acetate.
What is the InChI of 16-Dehydropregnenolone acetate?
The InChI of 16-Dehydropregnenolone acetate is InChI=1S/C23H32O3/c1-14(24)19-7-8-20-18-6-5-16-13-17(26-15(2)25)9-11-22(16,3)21(18)10-12-23(19,20)4/h5,7,17-18,20-21H,6,8-13H2,1-4H3/t17-,18-,20-,21-,22-,23+/m0/s1.
What is the InChIKey of 16-Dehydropregnenolone acetate?
The InChIKey of 16-Dehydropregnenolone acetate is MZWRIOUCMXPLKV-RFOVXIPZSA-N.
What is the canonical SMILES of 16-Dehydropregnenolone acetate?
The canonical SMILES of 16-Dehydropregnenolone acetate is CC(=O)C1=CCC2C1(CCC3C2CC=C4C3(CCC(C4)OC(=O)C)C).
What is the CAS number of 16-Dehydropregnenolone acetate?
The CAS number of 16-Dehydropregnenolone acetate is 979-02-2.
What is the EC number of 16-Dehydropregnenolone acetate?
The EC number of 16-Dehydropregnenolone acetate is 213-558-7.
What is the UNII of 16-Dehydropregnenolone acetate?
The UNII of 16-Dehydropregnenolone acetate is 832VMW7ZGC.
What is the ChEMBL ID of 16-Dehydropregnenolone acetate?
The ChEMBL ID of 16-Dehydropregnenolone acetate is CHEMBL1761683.