What is the PubChem CID of 10-Carboxydecyl disulfide?
The PubChem CID of 10-Carboxydecyl disulfide is 15748524.
What is the molecular formula of 10-Carboxydecyl disulfide?
The molecular formula of 10-Carboxydecyl disulfide is C22H42O4S2.
What is the molecular weight of 10-Carboxydecyl disulfide?
The molecular weight of 10-Carboxydecyl disulfide is 434.7 g/mol.
What are the synonyms of 10-Carboxydecyl disulfide?
The synonyms of 10-Carboxydecyl disulfide are Bis(10-carboxydecyl)disulfide, 23483-56-9, 11-(10-carboxydecyldisulfanyl)undecanoic acid, and 11,11'-Disulfanediyldiundecanoic acid.
What is the IUPAC name of 10-Carboxydecyl disulfide?
The IUPAC name of 10-Carboxydecyl disulfide is 11-(10-carboxydecyldisulfanyl)undecanoic acid.
What is the InChI of 10-Carboxydecyl disulfide?
The InChI of 10-Carboxydecyl disulfide is InChI=1S/C22H42O4S2/c23-21(24)17-13-9-5-1-3-7-11-15-19-27-28-20-16-12-8-4-2-6-10-14-18-22(25)26/h1-20H2,(H,23,24)(H,25,26).
What is the InChIKey of 10-Carboxydecyl disulfide?
The InChIKey of 10-Carboxydecyl disulfide is ZVJYVLSWSYMCMF-UHFFFAOYSA-N.
What is the canonical SMILES of 10-Carboxydecyl disulfide?
The canonical SMILES of 10-Carboxydecyl disulfide is C(CCCCCSSCCCCCCCCCCC(=O)O)CCCCC(=O)O.
What is the CAS number of 10-Carboxydecyl disulfide?
The CAS number of 10-Carboxydecyl disulfide is 23483-56-9.
What is the European Community (EC) number of 10-Carboxydecyl disulfide?
The European Community (EC) number of 10-Carboxydecyl disulfide is 636-605-7.
※ Please kindly note that our products are for research use only.