What is the PubChem CID of 1-vinylnaphthalene?
PubChem CID 70004
What is the molecular formula of 1-vinylnaphthalene?
The molecular formula is C12H10.
What is the molecular weight of 1-vinylnaphthalene?
The molecular weight is 154.21 g/mol.
What is the IUPAC name of 1-vinylnaphthalene?
The IUPAC name is 1-ethenylnaphthalene.
What is the InChI of 1-vinylnaphthalene?
The InChI is InChI=1S/C12H10/c1-2-10-7-5-8-11-6-3-4-9-12(10)11/h2-9H,1H2.
What is the InChIKey of 1-vinylnaphthalene?
The InChIKey is IGGDKDTUCAWDAN-UHFFFAOYSA-N.
What is the canonical SMILES of 1-vinylnaphthalene?
The canonical SMILES is C=CC1=CC=CC2=CC=CC=C21.
What is the CAS number of 1-vinylnaphthalene?
The CAS number is 826-74-4.
What is the European Community (EC) number of 1-vinylnaphthalene?
The EC number is 247-828-0.
What is the XLogP3 value of 1-vinylnaphthalene?
The XLogP3 value is 4.3.