What is the molecular formula of 1-Pyrenebutyric acid?
The molecular formula of 1-Pyrenebutyric acid is C20H16O2.
What is the molecular weight of 1-Pyrenebutyric acid?
The molecular weight of 1-Pyrenebutyric acid is 288.3 g/mol.
What is the IUPAC name of 1-Pyrenebutyric acid?
The IUPAC name of 1-Pyrenebutyric acid is 4-pyren-1-ylbutanoic acid.
What is the InChI of 1-Pyrenebutyric acid?
The InChI of 1-Pyrenebutyric acid is InChI=1S/C20H16O2/c21-18(22)6-2-3-13-7-8-16-10-9-14-4-1-5-15-11-12-17(13)20(16)19(14)15/h1,4-5,7-12H,2-3,6H2,(H,21,22).
What is the InChIKey of 1-Pyrenebutyric acid?
The InChIKey of 1-Pyrenebutyric acid is QXYRRCOJHNZVDJ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Pyrenebutyric acid?
The canonical SMILES of 1-Pyrenebutyric acid is C1=CC2=C3C(=C1)C=CC4=C(C=CC(=C43)C=C2)CCCC(=O)O.
What is the CAS number of 1-Pyrenebutyric acid?
The CAS number of 1-Pyrenebutyric acid is 3443-45-6.
What is the XLogP3-AA value of 1-Pyrenebutyric acid?
The XLogP3-AA value of 1-Pyrenebutyric acid is 5.1.
How many hydrogen bond donor counts does 1-Pyrenebutyric acid have?
1-Pyrenebutyric acid has 1 hydrogen bond donor count.
How many rotatable bond counts does 1-Pyrenebutyric acid have?
1-Pyrenebutyric acid has 4 rotatable bond counts.