What is the PubChem CID of 1-Phenylpiperazine?
The PubChem CID of 1-Phenylpiperazine is 7096.
What is the molecular formula of 1-Phenylpiperazine?
The molecular formula of 1-Phenylpiperazine is C10H14N2.
What is the molecular weight of 1-Phenylpiperazine?
The molecular weight of 1-Phenylpiperazine is 162.23 g/mol.
What is the IUPAC name of 1-Phenylpiperazine?
The IUPAC name of 1-Phenylpiperazine is 1-phenylpiperazine.
What is the InChI of 1-Phenylpiperazine?
The InChI of 1-Phenylpiperazine is InChI=1S/C10H14N2/c1-2-4-10(5-3-1)12-8-6-11-7-9-12/h1-5,11H,6-9H2.
What is the InChIKey of 1-Phenylpiperazine?
The InChIKey of 1-Phenylpiperazine is YZTJYBJCZXZGCT-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Phenylpiperazine?
The canonical SMILES of 1-Phenylpiperazine is C1CN(CCN1)C2=CC=CC=C2.
What is the CAS number of 1-Phenylpiperazine?
The CAS number of 1-Phenylpiperazine is 92-54-6.
What is the XLogP3 value of 1-Phenylpiperazine?
The XLogP3 value of 1-Phenylpiperazine is 1.1.
What is the hydrogen bond donor count of 1-Phenylpiperazine?
The hydrogen bond donor count of 1-Phenylpiperazine is 1.