What is the molecular formula of 1-Octyn-3-ol?
The molecular formula of 1-Octyn-3-ol is C8H14O.
What is the molecular weight of 1-Octyn-3-ol?
The molecular weight of 1-Octyn-3-ol is 126.20 g/mol.
What is the IUPAC name of 1-Octyn-3-ol?
The IUPAC name of 1-Octyn-3-ol is oct-1-yn-3-ol.
What is the InChI of 1-Octyn-3-ol?
The InChI of 1-Octyn-3-ol is InChI=1S/C8H14O/c1-3-5-6-7-8(9)4-2/h2,8-9H,3,5-7H2,1H3.
What is the InChIKey of 1-Octyn-3-ol?
The InChIKey of 1-Octyn-3-ol is VUGRNZHKYVHZSN-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Octyn-3-ol?
The canonical SMILES of 1-Octyn-3-ol is CCCCCC(C#C)O.
What is the CAS number of 1-Octyn-3-ol?
The CAS number of 1-Octyn-3-ol is 818-72-4.
What is the XLogP3-AA value of 1-Octyn-3-ol?
The XLogP3-AA value of 1-Octyn-3-ol is 2.
How many rotatable bonds does 1-Octyn-3-ol have?
1-Octyn-3-ol has 4 rotatable bonds.
Does 1-Octyn-3-ol have any defined atom stereocenter count?
No, 1-Octyn-3-ol does not have any defined atom stereocenter count.