Metal Plating, Electropolishing, Metal Reprocessing, Phase transfer media, Batteries Fuel Cells, Nanomaterials, Industrial Solvents, Nuclear Fuel Red Waste, Enzymatic Catalysis, Lubricants Heat Transfer and Solar Energy Conversion.
The price of 1-octyl-2,3-dimethylimidazolium chloride is moderate and the quality is guaranteed.
What is the molecular formula of 1-octyl-2,3-dimethylimidazolium chloride?
The molecular formula is C13H25ClN2.
What are the synonyms for 1-octyl-2,3-dimethylimidazolium chloride?
The synonyms include 1-Octyl-2,3-Dimethylimidazolium Chloride, 1007398-58-4, 1,2-Dimethyl-3-octyl-1H-imidazol-3-ium chloride, and 2,3-Dimethyl-1-octyl-1H-imidazol-3-ium chloride.
What is the molecular weight of 1-octyl-2,3-dimethylimidazolium chloride?
The molecular weight is 244.80 g/mol.
What is the IUPAC name of 1-octyl-2,3-dimethylimidazolium chloride?
The IUPAC name is 1,2-dimethyl-3-octylimidazol-1-ium chloride.
What is the InChI of 1-octyl-2,3-dimethylimidazolium chloride?
The InChI is InChI=1S/C13H25N2.ClH/c1-4-5-6-7-8-9-10-15-12-11-14(3)13(15)2;/h11-12H,4-10H2,1-3H3;1H/q+1;/p-1.
What is the InChIKey of 1-octyl-2,3-dimethylimidazolium chloride?
The InChIKey is YDTHOJLJYVCNIM-UHFFFAOYSA-M.
What is the canonical SMILES of 1-octyl-2,3-dimethylimidazolium chloride?
The canonical SMILES is CCCCCCCCN1C=C[N+](=C1C)C.[Cl-].
What is the CAS number of 1-octyl-2,3-dimethylimidazolium chloride?
The CAS number is 1007398-58-4.
What is the hydrogen bond donor count of 1-octyl-2,3-dimethylimidazolium chloride?
The hydrogen bond donor count is 0.
Is 1-octyl-2,3-dimethylimidazolium chloride a canonicalized compound?
Yes, it is a canonicalized compound.
※ Please kindly note that our products are for research use only.