What is the molecular formula of 1-Naphthalenethiol?
The molecular formula of 1-Naphthalenethiol is C10H8S.
What is the molecular weight of 1-Naphthalenethiol?
The molecular weight of 1-Naphthalenethiol is 160.24 g/mol.
What is the IUPAC name of 1-Naphthalenethiol?
The IUPAC name of 1-Naphthalenethiol is naphthalene-1-thiol.
What is the InChI of 1-Naphthalenethiol?
The InChI of 1-Naphthalenethiol is InChI=1S/C10H8S/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7,11H.
What is the InChIKey of 1-Naphthalenethiol?
The InChIKey of 1-Naphthalenethiol is SEXOVMIIVBKGGM-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Naphthalenethiol?
The canonical SMILES of 1-Naphthalenethiol is C1=CC=C2C(=C1)C=CC=C2S.
What is the CAS number of 1-Naphthalenethiol?
The CAS number of 1-Naphthalenethiol is 529-36-2.
What is the European Community (EC) number of 1-Naphthalenethiol?
The European Community (EC) number of 1-Naphthalenethiol is 208-462-7.
What is the UNII of 1-Naphthalenethiol?
The UNII of 1-Naphthalenethiol is 9A78CP495H.
What is the Wikipedia page for 1-Naphthalenethiol?
The Wikipedia page for 1-Naphthalenethiol is "1-Naphthalenethiol".