What is the PubChem CID of 1-Methylcyclohexanol?
The PubChem CID of 1-Methylcyclohexanol is 11550.
What is the molecular formula of 1-Methylcyclohexanol?
The molecular formula of 1-Methylcyclohexanol is C7H14O.
What is the molecular weight of 1-Methylcyclohexanol?
The molecular weight of 1-Methylcyclohexanol is 114.19 g/mol.
What is the IUPAC name of 1-Methylcyclohexanol?
The IUPAC name of 1-Methylcyclohexanol is 1-methylcyclohexan-1-ol.
What is the InChI of 1-Methylcyclohexanol?
The InChI of 1-Methylcyclohexanol is InChI=1S/C7H14O/c1-7(8)5-3-2-4-6-7/h8H,2-6H2,1H3.
What is the InChIKey of 1-Methylcyclohexanol?
The InChIKey of 1-Methylcyclohexanol is VTBOTOBFGSVRMA-UHFFFAOYSA-N.
What is the CAS number of 1-Methylcyclohexanol?
The CAS number of 1-Methylcyclohexanol is 590-67-0.
What is the European Community (EC) number of 1-Methylcyclohexanol?
The European Community (EC) number of 1-Methylcyclohexanol is 209-688-9.
What is the DSSTox Substance ID of 1-Methylcyclohexanol?
The DSSTox Substance ID of 1-Methylcyclohexanol is DTXSID00207739.
What is the Topological Polar Surface Area of 1-Methylcyclohexanol?
The Topological Polar Surface Area of 1-Methylcyclohexanol is 20.2Ų.