What is the molecular formula of 1-Hexadecylhydantoin?
The molecular formula of 1-Hexadecylhydantoin is C19H36N2O2.
What are the synonyms for 1-Hexadecylhydantoin?
The synonyms for 1-Hexadecylhydantoin include 1-N-Hexadecyl hydantoin and 1-Hexadecylimidazolidine-2,4-dione.
What is the molecular weight of 1-Hexadecylhydantoin?
The molecular weight of 1-Hexadecylhydantoin is 324.5 g/mol.
How was the molecular weight computed?
The molecular weight was computed by PubChem 2.1.
When was 1-Hexadecylhydantoin created?
1-Hexadecylhydantoin was created on August 8, 2005.
When was 1-Hexadecylhydantoin last modified?
1-Hexadecylhydantoin was last modified on October 21, 2023.
What is the IUPAC name of 1-Hexadecylhydantoin?
The IUPAC name of 1-Hexadecylhydantoin is 1-hexadecylimidazolidine-2,4-dione.
What is the InChI of 1-Hexadecylhydantoin?
The InChI of 1-Hexadecylhydantoin is InChI=1S/C19H36N2O2/c1-2-3-4-5-6-7-8-9-10-11-12-13-14-15-16-21-17-18(22)20-19(21)23/h2-17H2,1H3,(H,20,22,23).
What is the InChIKey of 1-Hexadecylhydantoin?
The InChIKey of 1-Hexadecylhydantoin is DRKXRVWPYXYCMR-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Hexadecylhydantoin?
The canonical SMILES of 1-Hexadecylhydantoin is CCCCCCCCCCCCCCCC1CC(=O)NC1=O.