What is the molecular formula of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The molecular formula is C11H21F6N2P.
What are the synonyms for 1-heptyl-3-methylimidazolium hexafluorophosphate?
The synonyms are 357915-04-9, 1-Heptyl-3-Methyl-Imidazolium Hexafluorophosphate, 1-Heptyl-3-Methylimidazol-3-ium;hexafluorophosphate, MFCD10566382, and 1-heptyl-3-methylimidazol-3-ium;hexafluorophosphate.
What is the molecular weight of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The molecular weight is 326.26 g/mol.
When was 1-heptyl-3-methylimidazolium hexafluorophosphate created?
It was created on May 9, 2013.
When was 1-heptyl-3-methylimidazolium hexafluorophosphate last modified?
It was last modified on December 30, 2023.
What is the IUPAC name of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The IUPAC name is 1-heptyl-3-methylimidazol-3-ium;hexafluorophosphate.
What is the InChI of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The InChI is InChI=1S/C11H21N2.F6P/c1-3-4-5-6-7-8-13-10-9-12(2)11-13;1-7(2,3,4,5)6/h9-11H,3-8H2,1-2H3;/q+1;-1.
What is the InChIKey of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The InChIKey is GWAHJEIEGVIPMZ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The canonical SMILES is CCCCCCCN1C=C[N+](=C1)C.F[P-](F)(F)(F)(F)F.
What is the hydrogen bond donor count of 1-heptyl-3-methylimidazolium hexafluorophosphate?
The hydrogen bond donor count is 0.
※ Please kindly note that our products are for research use only.