What is the molecular formula of 1-Ethylcyclopentanol?
The molecular formula of 1-Ethylcyclopentanol is C7H14O.
What is the molecular weight of 1-Ethylcyclopentanol?
The molecular weight of 1-Ethylcyclopentanol is 114.19 g/mol.
What is the IUPAC name of 1-Ethylcyclopentanol?
The IUPAC name of 1-Ethylcyclopentanol is 1-ethylcyclopentan-1-ol.
What is the InChI of 1-Ethylcyclopentanol?
The InChI of 1-Ethylcyclopentanol is InChI=1S/C7H14O/c1-2-7(8)5-3-4-6-7/h8H,2-6H2,1H3.
What is the InChIKey of 1-Ethylcyclopentanol?
The InChIKey of 1-Ethylcyclopentanol is LPCWIFPJLFCXRS-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Ethylcyclopentanol?
The canonical SMILES of 1-Ethylcyclopentanol is CCC1(CCCC1)O.
What is the CAS number of 1-Ethylcyclopentanol?
The CAS number of 1-Ethylcyclopentanol is 1462-96-0.
What is the XLogP3-AA value of 1-Ethylcyclopentanol?
The XLogP3-AA value of 1-Ethylcyclopentanol is 1.5.
How many hydrogen bond donor counts does 1-Ethylcyclopentanol have?
1-Ethylcyclopentanol has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1-Ethylcyclopentanol have?
1-Ethylcyclopentanol has 1 hydrogen bond acceptor count.