What is the chemical structure of 1-Cyclopropylethanol?
The chemical structure of 1-Cyclopropylethanol is C5H10O.
What is the molecular weight of 1-Cyclopropylethanol?
The molecular weight of 1-Cyclopropylethanol is 86.13 g/mol.
What is the IUPAC name of 1-Cyclopropylethanol?
The IUPAC name of 1-Cyclopropylethanol is 1-cyclopropylethanol.
What is the InChI of 1-Cyclopropylethanol?
The InChI of 1-Cyclopropylethanol is InChI=1S/C5H10O/c1-4(6)5-2-3-5/h4-6H,2-3H2,1H3.
What is the InChIKey of 1-Cyclopropylethanol?
The InChIKey of 1-Cyclopropylethanol is DKKVKJZXOBFLRY-UHFFFAOYSA-N.
What is the CAS number of 1-Cyclopropylethanol?
The CAS number of 1-Cyclopropylethanol is 765-42-4.
What is the XLogP3-AA value of 1-Cyclopropylethanol?
The XLogP3-AA value of 1-Cyclopropylethanol is 0.7.
How many hydrogen bond donor counts are there in 1-Cyclopropylethanol?
There is 1 hydrogen bond donor count in 1-Cyclopropylethanol.
How many hydrogen bond acceptor counts are there in 1-Cyclopropylethanol?
There is 1 hydrogen bond acceptor count in 1-Cyclopropylethanol.
How many rotatable bond counts are there in 1-Cyclopropylethanol?
There is 1 rotatable bond count in 1-Cyclopropylethanol.