What is the PubChem CID of 1-Chlorobutanone?
The PubChem CID of 1-Chlorobutanone is 69219.
What is the molecular formula of 1-Chlorobutanone?
The molecular formula of 1-Chlorobutanone is C4H7ClO.
What is the molecular weight of 1-Chlorobutanone?
The molecular weight of 1-Chlorobutanone is 106.55 g/mol.
What is the IUPAC name of 1-Chlorobutanone?
The IUPAC name of 1-Chlorobutanone is 1-chlorobutan-2-one.
What is the InChI of 1-Chlorobutanone?
The InChI of 1-Chlorobutanone is InChI=1S/C4H7ClO/c1-2-4(6)3-5/h2-3H2,1H3.
What is the InChIKey of 1-Chlorobutanone?
The InChIKey of 1-Chlorobutanone is AALRHBLMAVGWRR-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Chlorobutanone?
The canonical SMILES of 1-Chlorobutanone is CCC(=O)CCl.
What is the CAS number of 1-Chlorobutanone?
The CAS number of 1-Chlorobutanone is 616-27-3.
What is the European Community (EC) number of 1-Chlorobutanone?
The European Community (EC) number of 1-Chlorobutanone is 210-473-7.
Is 1-Chlorobutanone a canonicalized compound?
Yes, 1-Chlorobutanone is a canonicalized compound.