What is the molecular formula of 1-Bromonaphthalene?
The molecular formula of 1-Bromonaphthalene is C10H7Br.
What is the molecular weight of 1-Bromonaphthalene?
The molecular weight of 1-Bromonaphthalene is 207.07 g/mol.
What is the IUPAC name of 1-Bromonaphthalene?
The IUPAC name of 1-Bromonaphthalene is 1-bromonaphthalene.
What is the InChI of 1-Bromonaphthalene?
The InChI of 1-Bromonaphthalene is InChI=1S/C10H7Br/c11-10-7-3-5-8-4-1-2-6-9(8)10/h1-7H.
What is the InChIKey of 1-Bromonaphthalene?
The InChIKey of 1-Bromonaphthalene is DLKQHBOKULLWDQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1-Bromonaphthalene?
The canonical SMILES of 1-Bromonaphthalene is C1=CC=C2C(=C1)C=CC=C2Br.
What is the CAS number of 1-Bromonaphthalene?
The CAS number of 1-Bromonaphthalene is 90-11-9.
What is the European Community (EC) Number of 1-Bromonaphthalene?
The European Community (EC) Number of 1-Bromonaphthalene is 201-965-2.
What is the UNII of 1-Bromonaphthalene?
The UNII of 1-Bromonaphthalene is 976Y53P08P.
Is 1-Bromonaphthalene a canonicalized compound?
Yes, 1-Bromonaphthalene is a canonicalized compound.