What is the molecular formula of 3,5-Dichlorobromobenzene?
The molecular formula of 3,5-Dichlorobromobenzene is C6H3BrCl2.
What is the molecular weight of 3,5-Dichlorobromobenzene?
The molecular weight of 3,5-Dichlorobromobenzene is 225.89 g/mol.
What is the CAS number of 3,5-Dichlorobromobenzene?
The CAS number of 3,5-Dichlorobromobenzene is 19752-55-7.
What is the IUPAC name of 3,5-Dichlorobromobenzene?
The IUPAC name of 3,5-Dichlorobromobenzene is 1-bromo-3,5-dichlorobenzene.
What is the InChI representation of 3,5-Dichlorobromobenzene?
The InChI representation of 3,5-Dichlorobromobenzene is InChI=1S/C6H3BrCl2/c7-4-1-5(8)3-6(9)2-4/h1-3H.
What is the InChIKey of 3,5-Dichlorobromobenzene?
The InChIKey of 3,5-Dichlorobromobenzene is DZHFFMWJXJBBRG-UHFFFAOYSA-N.
What is the Canonical SMILES of 3,5-Dichlorobromobenzene?
The Canonical SMILES of 3,5-Dichlorobromobenzene is C1=C(C=C(C=C1Cl)Br)Cl.
What is the XLogP3 value of 3,5-Dichlorobromobenzene?
The XLogP3 value of 3,5-Dichlorobromobenzene is 4.3.
How many hydrogen bond donor counts are there in 3,5-Dichlorobromobenzene?
There are 0 hydrogen bond donor counts in 3,5-Dichlorobromobenzene.
Is 3,5-Dichlorobromobenzene a canonical compound?
Yes, 3,5-Dichlorobromobenzene is a canonical compound.