What is the molecular formula of 2-Bromofluorobenzene?
The molecular formula of 2-Bromofluorobenzene is C6H4BrF.
What is the molecular weight of 2-Bromofluorobenzene?
The molecular weight of 2-Bromofluorobenzene is 175.00 g/mol.
What is the IUPAC name of 2-Bromofluorobenzene?
The IUPAC name of 2-Bromofluorobenzene is 1-bromo-2-fluorobenzene.
What is the InChI of 2-Bromofluorobenzene?
The InChI of 2-Bromofluorobenzene is InChI=1S/C6H4BrF/c7-5-3-1-2-4-6(5)8/h1-4H.
What is the InChIKey of 2-Bromofluorobenzene?
The InChIKey of 2-Bromofluorobenzene is IPWBFGUBXWMIPR-UHFFFAOYSA-N.
What is the Canonical SMILES of 2-Bromofluorobenzene?
The Canonical SMILES of 2-Bromofluorobenzene is C1=CC=C(C(=C1)F)Br.
What is the CAS number of 2-Bromofluorobenzene?
The CAS number of 2-Bromofluorobenzene is 1072-85-1.
What is the European Community (EC) number of 2-Bromofluorobenzene?
The European Community (EC) number of 2-Bromofluorobenzene is 214-018-3.
What is the DSSTox Substance ID of 2-Bromofluorobenzene?
The DSSTox Substance ID of 2-Bromofluorobenzene is DTXSID5061459.
Is 2-Bromofluorobenzene a canonicalized compound?
Yes, 2-Bromofluorobenzene is a canonicalized compound.