What is the molecular formula of 1-Boc-indole-5-boronic acid pinacol ester?
The molecular formula of 1-Boc-indole-5-boronic acid pinacol ester is C19H26BNO4.
What is the molecular weight of 1-Boc-indole-5-boronic acid pinacol ester?
The molecular weight of 1-Boc-indole-5-boronic acid pinacol ester is 343.2 g/mol.
What is the IUPAC name of 1-Boc-indole-5-boronic acid pinacol ester?
The IUPAC name of 1-Boc-indole-5-boronic acid pinacol ester is tert-butyl 5-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)indole-1-carboxylate.
What is the InChI of 1-Boc-indole-5-boronic acid pinacol ester?
The InChI of 1-Boc-indole-5-boronic acid pinacol ester is InChI=1S/C19H26BNO4/c1-17(2,3)23-16(22)21-11-10-13-12-14(8-9-15(13)21)20-24-18(4,5)19(6,7)25-20/h8-12H,1-7H3.
What is the InChIKey of 1-Boc-indole-5-boronic acid pinacol ester?
The InChIKey of 1-Boc-indole-5-boronic acid pinacol ester is WPSDWNFTICAMNI-UHFFFAOYSA-N.
What is the Canonical SMILES of 1-Boc-indole-5-boronic acid pinacol ester?
The Canonical SMILES of 1-Boc-indole-5-boronic acid pinacol ester is B1(OC(C(O1)(C)C)(C)C)C2=CC3=C(C=C2)N(C=C3)C(=O)OC(C)(C)C.
What is the CAS number of 1-Boc-indole-5-boronic acid pinacol ester?
The CAS number of 1-Boc-indole-5-boronic acid pinacol ester is 777061-36-6.
What is the European Community (EC) number of 1-Boc-indole-5-boronic acid pinacol ester?
The European Community (EC) number of 1-Boc-indole-5-boronic acid pinacol ester is 674-995-0.
What is the DSSTox Substance ID of 1-Boc-indole-5-boronic acid pinacol ester?
The DSSTox Substance ID of 1-Boc-indole-5-boronic acid pinacol ester is DTXSID40373841.
Is 1-Boc-indole-5-boronic acid pinacol ester considered as a canonicalized compound?
Yes, 1-Boc-indole-5-boronic acid pinacol ester is considered as a canonicalized compound.
※ Please kindly note that our products are for research use only.