The synonyms of the compound are 62649-65-4, 1-Amino-4-((1-methylethyl)amino)anthraquinone, 1-amino-4-(propan-2-ylamino)anthracene-9,10-dione, and 1-AMINO-4-[(1-METHYLETHYL)AMINO]ANTHRAQUINONE.
What is the molecular weight of the compound?
The molecular weight of the compound is 280.32 g/mol.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 1-amino-4-(propan-2-ylamino)anthracene-9,10-dione.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C17H16N2O2/c1-9(2)19-13-8-7-12(18)14-15(13)17(21)11-6-4-3-5-10(11)16(14)20/h3-9,19H,18H2,1-2H3.
What is the InChIKey of the compound?
The InChIKey of the compound is XESMZIWBJZMRDK-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)NC1=C2C(=C(C=C1)N)C(=O)C3=CC=CC=C3C2=O.
What is the CAS number of the compound?
The CAS number of the compound is 62649-65-4.
What is the hydrogen bond donor count of the compound?
The hydrogen bond donor count of the compound is 2.
※ Please kindly note that our products are for research use only.