What is the molecular formula of 1,5-Hexadien-3-ol?
The molecular formula of 1,5-Hexadien-3-ol is C6H10O.
What is the molecular weight of 1,5-Hexadien-3-ol?
The molecular weight of 1,5-Hexadien-3-ol is 98.14 g/mol.
What is the IUPAC name of 1,5-Hexadien-3-ol?
The IUPAC name of 1,5-Hexadien-3-ol is hexa-1,5-dien-3-ol.
What is the InChI of 1,5-Hexadien-3-ol?
The InChI of 1,5-Hexadien-3-ol is InChI=1S/C6H10O/c1-3-5-6(7)4-2/h3-4,6-7H,1-2,5H2.
What is the InChIKey of 1,5-Hexadien-3-ol?
The InChIKey of 1,5-Hexadien-3-ol is SZYLTIUVWARXOO-UHFFFAOYSA-N.
What is the Canonical SMILES of 1,5-Hexadien-3-ol?
The Canonical SMILES of 1,5-Hexadien-3-ol is C=CCC(C=C)O.
What is the CAS number of 1,5-Hexadien-3-ol?
The CAS number of 1,5-Hexadien-3-ol is 924-41-4.
What is the European Community (EC) number of 1,5-Hexadien-3-ol?
The European Community (EC) number of 1,5-Hexadien-3-ol is 213-102-7.
What is the UNII of 1,5-Hexadien-3-ol?
The UNII of 1,5-Hexadien-3-ol is C38864PH9K.
Is 1,5-Hexadien-3-ol a canonicalized compound?
Yes, 1,5-Hexadien-3-ol is a canonicalized compound.