What is the molecular formula of 1,4-Pentadien-3-ol?
The molecular formula is C5H8O.
What is the molecular weight of 1,4-Pentadien-3-ol?
The molecular weight is 84.12 g/mol.
What is the IUPAC Name of 1,4-Pentadien-3-ol?
The IUPAC name is penta-1,4-dien-3-ol.
What is the InChI of 1,4-Pentadien-3-ol?
The InChI is InChI=1S/C5H8O/c1-3-5(6)4-2/h3-6H,1-2H2.
What is the InChIKey of 1,4-Pentadien-3-ol?
The InChIKey is ICMWSAALRSINTC-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Pentadien-3-ol?
The canonical SMILES is C=CC(C=C)O.
What is the CAS number of 1,4-Pentadien-3-ol?
The CAS number is 922-65-6.
What is the European Community (EC) Number of 1,4-Pentadien-3-ol?
The European Community (EC) Number is 213-080-9.
What is the DSSTox Substance ID of 1,4-Pentadien-3-ol?
The DSSTox Substance ID is DTXSID00238922.
What is the XLogP3-AA value of 1,4-Pentadien-3-ol?
The XLogP3-AA value is 1.