What is the molecular formula of 1,4-Diphenylbutane?
The molecular formula of 1,4-Diphenylbutane is C16H18.
What is the molecular weight of 1,4-Diphenylbutane?
The molecular weight of 1,4-Diphenylbutane is 210.31 g/mol.
What is the IUPAC name of 1,4-Diphenylbutane?
The IUPAC name of 1,4-Diphenylbutane is 4-phenylbutylbenzene.
What is the InChI of 1,4-Diphenylbutane?
The InChI of 1,4-Diphenylbutane is InChI=1S/C16H18/c1-3-9-15(10-4-1)13-7-8-14-16-11-5-2-6-12-16/h1-6,9-12H,7-8,13-14H2.
What is the InChIKey of 1,4-Diphenylbutane?
The InChIKey of 1,4-Diphenylbutane is GLJFYGFBITUZOE-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Diphenylbutane?
The canonical SMILES of 1,4-Diphenylbutane is C1=CC=C(C=C1)CCCCC2=CC=CC=C2.
What is the CAS number of 1,4-Diphenylbutane?
The CAS number of 1,4-Diphenylbutane is 1083-56-3.
What is the XLogP3 value of 1,4-Diphenylbutane?
The XLogP3 value of 1,4-Diphenylbutane is 4.
What is the hydrogen bond donor count of 1,4-Diphenylbutane?
The hydrogen bond donor count of 1,4-Diphenylbutane is 0.
What is the hydrogen bond acceptor count of 1,4-Diphenylbutane?
The hydrogen bond acceptor count of 1,4-Diphenylbutane is not provided in the reference.