What is the molecular formula of 1,4-Diiodo-2,5-dioctylbenzene?
The molecular formula of 1,4-Diiodo-2,5-dioctylbenzene is C22H36I2.
What is the molecular weight of 1,4-Diiodo-2,5-dioctylbenzene?
The molecular weight of 1,4-Diiodo-2,5-dioctylbenzene is 554.3 g/mol.
What is the IUPAC name of 1,4-Diiodo-2,5-dioctylbenzene?
The IUPAC name of 1,4-Diiodo-2,5-dioctylbenzene is 1,4-diiodo-2,5-dioctylbenzene.
What is the InChI of 1,4-Diiodo-2,5-dioctylbenzene?
The InChI of 1,4-Diiodo-2,5-dioctylbenzene is InChI=1S/C22H36I2/c1-3-5-7-9-11-13-15-19-17-22(24)20(18-21(19)23)16-14-12-10-8-6-4-2/h17-18H,3-16H2,1-2H3.
What is the InChIKey of 1,4-Diiodo-2,5-dioctylbenzene?
The InChIKey of 1,4-Diiodo-2,5-dioctylbenzene is JNTDOQWSWMNCCX-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Diiodo-2,5-dioctylbenzene?
The canonical SMILES of 1,4-Diiodo-2,5-dioctylbenzene is CCCCCCCCC1=CC(=C(C=C1I)CCCCCCCC)I.
What is the CAS number of 1,4-Diiodo-2,5-dioctylbenzene?
The CAS number of 1,4-Diiodo-2,5-dioctylbenzene is 171569-01-0.
What is the European Community (EC) number of 1,4-Diiodo-2,5-dioctylbenzene?
The European Community (EC) number of 1,4-Diiodo-2,5-dioctylbenzene is 622-656-2.
What is the DSSTox Substance ID of 1,4-Diiodo-2,5-dioctylbenzene?
The DSSTox Substance ID of 1,4-Diiodo-2,5-dioctylbenzene is DTXSID50584522.
Is 1,4-Diiodo-2,5-dioctylbenzene a canonicalized compound?
Yes, 1,4-Diiodo-2,5-dioctylbenzene is a canonicalized compound according to PubChem.
※ Please kindly note that our products are for research use only.