What is the molecular formula of 1,4-Dibromocyclohexane?
The molecular formula of 1,4-Dibromocyclohexane is C6H10Br2.
What are the synonyms of 1,4-Dibromocyclohexane?
The synonyms of 1,4-Dibromocyclohexane are 1,4-DIBROMOCYCLOHEXANE, 35076-92-7, 13618-83-2, Cyclohexane, 1,4-dibromo-, TRANS-1,4-DIBROMOCYCLOHEXANE, 1beta,4alpha-Dibromocyclohexane, and more.
What is the IUPAC name of 1,4-Dibromocyclohexane?
The IUPAC name of 1,4-Dibromocyclohexane is 1,4-dibromocyclohexane.
What is the InChI of 1,4-Dibromocyclohexane?
The InChI of 1,4-Dibromocyclohexane is InChI=1S/C6H10Br2/c7-5-1-2-6(8)4-3-5/h5-6H,1-4H2.
What is the InChIKey of 1,4-Dibromocyclohexane?
The InChIKey of 1,4-Dibromocyclohexane is OALGWDQLKYPDRK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,4-Dibromocyclohexane?
The canonical SMILES of 1,4-Dibromocyclohexane is C1CC(CCC1Br)Br.
What is the CAS number of 1,4-Dibromocyclohexane?
The CAS number of 1,4-Dibromocyclohexane is 35076-92-7.
What is the molecular weight of 1,4-Dibromocyclohexane?
The molecular weight of 1,4-Dibromocyclohexane is 241.95g/mol.
What is the XLogP3 value of 1,4-Dibromocyclohexane?
The XLogP3 value of 1,4-Dibromocyclohexane is 3.1.
What is the Covalently-Bonded Unit Count of 1,4-Dibromocyclohexane?
The Covalently-Bonded Unit Count of 1,4-Dibromocyclohexane is 1.