What is the molecular formula of 1,3-dibromonaphthalene?
The molecular formula of 1,3-dibromonaphthalene is C10H6Br2.
When was 1,3-dibromonaphthalene created and last modified in PubChem?
1,3-dibromonaphthalene was created on October 26, 2006, and last modified on December 30, 2023.
What is the IUPAC name of 1,3-dibromonaphthalene?
The IUPAC name of 1,3-dibromonaphthalene is 1,3-dibromonaphthalene.
What is the Canonical SMILES representation of 1,3-dibromonaphthalene?
The Canonical SMILES representation of 1,3-dibromonaphthalene is C1=CC=C2C(=C1)C=C(C=C2Br)Br.
What is the CAS number of 1,3-dibromonaphthalene?
The CAS number of 1,3-dibromonaphthalene is 52358-73-3.
What is the molecular weight of 1,3-dibromonaphthalene?
The molecular weight of 1,3-dibromonaphthalene is 285.96 g/mol.
How many hydrogen bond donor counts does 1,3-dibromonaphthalene have?
1,3-dibromonaphthalene has 0 hydrogen bond donor counts.
What is the topological polar surface area of 1,3-dibromonaphthalene?
The topological polar surface area of 1,3-dibromonaphthalene is 0-2.
How many heavy atoms are present in 1,3-dibromonaphthalene?
There are 12 heavy atoms present in 1,3-dibromonaphthalene.
Is the compound canonicalized in PubChem?
Yes, the compound is canonicalized in PubChem.