What is the molecular formula of 1,3-Diamino-2-propanol?
The molecular formula is C3H10N2O.
What is the molecular weight of 1,3-Diamino-2-propanol?
The molecular weight is 90.12 g/mol.
What is the IUPAC name of 1,3-Diamino-2-propanol?
The IUPAC name is 1,3-diaminopropan-2-ol.
What is the InChI of 1,3-Diamino-2-propanol?
The InChI is InChI=1S/C3H10N2O/c4-1-3(6)2-5/h3,6H,1-2,4-5H2.
What is the InChIKey of 1,3-Diamino-2-propanol?
The InChIKey is UYBWIEGTWASWSR-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3-Diamino-2-propanol?
The canonical SMILES is C(C(CN)O)N.
What is the CAS number of 1,3-Diamino-2-propanol?
The CAS number is 616-29-5.
How many hydrogen bond donor counts does 1,3-Diamino-2-propanol have?
It has 3 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does 1,3-Diamino-2-propanol have?
It has 3 hydrogen bond acceptor counts.