What is the molecular formula of 1,3,5-Triethynylbenzene?
The molecular formula of 1,3,5-Triethynylbenzene is C12H6.
What is the molecular weight of 1,3,5-Triethynylbenzene?
The molecular weight of 1,3,5-Triethynylbenzene is 150.18 g/mol.
What is the IUPAC name of 1,3,5-Triethynylbenzene?
The IUPAC name of 1,3,5-Triethynylbenzene is 1,3,5-triethynylbenzene.
What is the InChI of 1,3,5-Triethynylbenzene?
The InChI of 1,3,5-Triethynylbenzene is InChI=1S/C12H6/c1-4-10-7-11(5-2)9-12(6-3)8-10/h1-3,7-9H.
What is the InChIKey of 1,3,5-Triethynylbenzene?
The InChIKey of 1,3,5-Triethynylbenzene is ZDRMMTYSQSIGRY-UHFFFAOYSA-N.
What is the canonical SMILES of 1,3,5-Triethynylbenzene?
The canonical SMILES of 1,3,5-Triethynylbenzene is C#CC1=CC(=CC(=C1)C#C)C#C.
What is the CAS number of 1,3,5-Triethynylbenzene?
The CAS number of 1,3,5-Triethynylbenzene is 7567-63-7.
What is the XLogP3-AA of 1,3,5-Triethynylbenzene?
The XLogP3-AA of 1,3,5-Triethynylbenzene is 2.7.
How many rotatable bonds does 1,3,5-Triethynylbenzene have?
1,3,5-Triethynylbenzene has 3 rotatable bonds.
Is 1,3,5-Triethynylbenzene a canonicalized compound?
Yes, 1,3,5-Triethynylbenzene is a canonicalized compound.