What is the PubChem CID of the compound?
The PubChem CID of the compound is 5071479.
What is the molecular formula of the compound?
The molecular formula of the compound is C32H74O13Si8.
When was the compound created?
The compound was created on September 18, 2005.
What is the IUPAC name of the compound?
The IUPAC name of the compound is 7,13-dihydroxy-1,3,5,7,9,11,13,15-octakis(2-methylpropyl)-2,4,6,8,10,12,14,16,17,18,19-undecaoxa-1,3,5,7,9,11,13,15-octasilatetracyclo[9.5.1.1 3,9 .1 5,15 ]nonadecane.
What is the InChI of the compound?
The InChI of the compound is InChI=1S/C32H74O13Si8/c1-25(2)17-46(33)35-48(19-27(5)6)39-50(21-29(9)10)37-47(34,18-26(3)4)38-51(22-30(11)12)40-49(36-46,20-28(7)8)42-52(41-48,23-31(13)14)45-53(43-50,44-51)24-32(15)16/h25-34H,17-24H2,1-16H3.
What is the InChIKey of the compound?
The InChIKey of the compound is ZJILJEYGMBWQKZ-UHFFFAOYSA-N.
What is the canonical SMILES of the compound?
The canonical SMILES of the compound is CC(C)C[Si]1(O[Si]2(O[Si]3(O[Si](O[Si]4(O[Si](O1)(O[Si](O2)(O[Si](O3)(O4)CC(C)C)CC(C)C)CC(C)C)CC(C)C)(CC(C)C)O)CC(C)C)CC(C)C)O.
What is the molecular weight of the compound?
The molecular weight of the compound is 891.6 g/mol.
How many hydrogen bond donor counts does the compound have?
The compound has 2 hydrogen bond donor counts.
How many hydrogen bond acceptor counts does the compound have?
The compound has 13 hydrogen bond acceptor counts.