What is the PubChem CID for 1,2-Tetradecanediol?
The PubChem CID for 1,2-Tetradecanediol is 89436.
What is the molecular formula of 1,2-Tetradecanediol?
The molecular formula of 1,2-Tetradecanediol is C14H30O2.
What is the molecular weight of 1,2-Tetradecanediol?
The molecular weight of 1,2-Tetradecanediol is 230.39 g/mol.
What is the IUPAC name of 1,2-Tetradecanediol?
The IUPAC name of 1,2-Tetradecanediol is tetradecane-1,2-diol.
What is the InChI of 1,2-Tetradecanediol?
The InChI of 1,2-Tetradecanediol is InChI=1S/C14H30O2/c1-2-3-4-5-6-7-8-9-10-11-12-14(16)13-15/h14-16H,2-13H2,1H3.
What is the Canonical SMILES of 1,2-Tetradecanediol?
The Canonical SMILES of 1,2-Tetradecanediol is CCCCCCCCCCCC(CO)O.
What is the CAS number of 1,2-Tetradecanediol?
The CAS number of 1,2-Tetradecanediol is 21129-09-9.
What is the European Community (EC) number of 1,2-Tetradecanediol?
The European Community (EC) number of 1,2-Tetradecanediol is 244-228-0.
What is the UNII of 1,2-Tetradecanediol?
The UNII of 1,2-Tetradecanediol is XJ32081WYO.
What is the XLogP3-AA value of 1,2-Tetradecanediol?
The XLogP3-AA value of 1,2-Tetradecanediol is 5.