What is the molecular formula of 1,2-Diiodobenzene?
The molecular formula of 1,2-Diiodobenzene is C6H4I2.
What is the molecular weight of 1,2-Diiodobenzene?
The molecular weight of 1,2-Diiodobenzene is 329.90 g/mol.
What is the IUPAC name of 1,2-Diiodobenzene?
The IUPAC name of 1,2-Diiodobenzene is 1,2-diiodobenzene.
What is the InChI of 1,2-Diiodobenzene?
The InChI of 1,2-Diiodobenzene is InChI=1S/C6H4I2/c7-5-3-1-2-4-6(5)8/h1-4H.
What is the InChIKey of 1,2-Diiodobenzene?
The InChIKey of 1,2-Diiodobenzene is BBOLNFYSRZVALD-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-Diiodobenzene?
The canonical SMILES of 1,2-Diiodobenzene is C1=CC=C(C(=C1)I)I.
What is the CAS number of 1,2-Diiodobenzene?
The CAS number of 1,2-Diiodobenzene is 615-42-9.
What is the European Community (EC) number of 1,2-Diiodobenzene?
The European Community (EC) number of 1,2-Diiodobenzene is 210-425-5.
What is the DSSTox Substance ID of 1,2-Diiodobenzene?
The DSSTox Substance ID of 1,2-Diiodobenzene is DTXSID0060648.
Is 1,2-Diiodobenzene a canonicalized compound?
Yes, 1,2-Diiodobenzene is a canonicalized compound.