What is the molecular formula of 1,2-dibromobutane?
The molecular formula of 1,2-dibromobutane is C4H8Br2.
What is the molecular weight of 1,2-dibromobutane?
The molecular weight of 1,2-dibromobutane is 215.91 g/mol.
What is the IUPAC name of 1,2-dibromobutane?
The IUPAC name of 1,2-dibromobutane is 1,2-dibromobutane.
What is the InChI of 1,2-dibromobutane?
The InChI of 1,2-dibromobutane is InChI=1S/C4H8Br2/c1-2-4(6)3-5/h4H,2-3H2,1H3.
What is the InChIKey of 1,2-dibromobutane?
The InChIKey of 1,2-dibromobutane is CZWSZZHGSNZRMW-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2-dibromobutane?
The canonical SMILES of 1,2-dibromobutane is CCC(CBr)Br.
What is the CAS number of 1,2-dibromobutane?
The CAS number of 1,2-dibromobutane is 533-98-2.
What is the XLogP3-AA value of 1,2-dibromobutane?
The XLogP3-AA value of 1,2-dibromobutane is 2.7.
How many rotatable bonds are present in 1,2-dibromobutane?
There are 2 rotatable bonds present in 1,2-dibromobutane.
Is 1,2-dibromobutane a canonicalized compound?
Yes, 1,2-dibromobutane is a canonicalized compound.