What is the molecular formula of 1-(2,5-Dimethylphenyl)ethanamine?
The molecular formula of 1-(2,5-Dimethylphenyl)ethanamine is C10H15N.
What are the synonyms of 1-(2,5-Dimethylphenyl)ethanamine?
The synonyms of 1-(2,5-Dimethylphenyl)ethanamine include 91251-26-2, 1-(2,5-dimethylphenyl)ethan-1-amine, Benzenemethanamine, alpha,2,5-trimethyl-, (S)- (9CI), and 1-(2,5-Dimethyl-phenyl)-ethylamine.
What is the molecular weight of 1-(2,5-Dimethylphenyl)ethanamine?
The molecular weight of 1-(2,5-Dimethylphenyl)ethanamine is 149.23 g/mol.
When was 1-(2,5-Dimethylphenyl)ethanamine created and modified?
1-(2,5-Dimethylphenyl)ethanamine was created on September 17, 2005, and modified on November 25, 2023.
What is the IUPAC name of 1-(2,5-Dimethylphenyl)ethanamine?
The IUPAC name of 1-(2,5-Dimethylphenyl)ethanamine is 1-(2,5-dimethylphenyl)ethanamine.
What is the InChI of 1-(2,5-Dimethylphenyl)ethanamine?
The InChI of 1-(2,5-Dimethylphenyl)ethanamine is InChI=1S/C10H15N/c1-7-4-5-8(2)10(6-7)9(3)11/h4-6,9H,11H2,1-3H3.
What is the InChIKey of 1-(2,5-Dimethylphenyl)ethanamine?
The InChIKey of 1-(2,5-Dimethylphenyl)ethanamine is ULGHUDXDTMIEAM-UHFFFAOYSA-N.
What is the canonical SMILES of 1-(2,5-Dimethylphenyl)ethanamine?
The canonical SMILES of 1-(2,5-Dimethylphenyl)ethanamine is CC1=CC(=C(C=C1)C)C(C)N.
What is the XLogP3-AA value of 1-(2,5-Dimethylphenyl)ethanamine?
The XLogP3-AA value of 1-(2,5-Dimethylphenyl)ethanamine is 1.9.
What is the hydrogen bond donor count of 1-(2,5-Dimethylphenyl)ethanamine?
The hydrogen bond donor count of 1-(2,5-Dimethylphenyl)ethanamine is 1.
※ Please kindly note that our products are for research use only.