What is the molecular formula of 1,2,4-butanetriol-1,4-dinitrate?
The molecular formula of 1,2,4-butanetriol-1,4-dinitrate is C4H8N2O7.
What are the synonyms for 1,2,4-butanetriol-1,4-dinitrate?
The synonyms for 1,2,4-butanetriol-1,4-dinitrate are (2-hydroxy-4-nitrooxybutyl) nitrate, 136765-55-4, SCHEMBL12880244, and AKOS006274507.
What is the molecular weight of 1,2,4-butanetriol-1,4-dinitrate?
The molecular weight of 1,2,4-butanetriol-1,4-dinitrate is 196.12 g/mol.
What is the IUPAC name of 1,2,4-butanetriol-1,4-dinitrate?
The IUPAC name of 1,2,4-butanetriol-1,4-dinitrate is (2-hydroxy-4-nitrooxybutyl) nitrate.
What is the InChI of 1,2,4-butanetriol-1,4-dinitrate?
The InChI of 1,2,4-butanetriol-1,4-dinitrate is InChI=1S/C4H8N2O7/c7-4(3-13-6(10)11)1-2-12-5(8)9/h4,7H,1-3H2.
What is the InChIKey of 1,2,4-butanetriol-1,4-dinitrate?
The InChIKey of 1,2,4-butanetriol-1,4-dinitrate is UTVLJENCCRCOKQ-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,4-butanetriol-1,4-dinitrate?
The canonical SMILES of 1,2,4-butanetriol-1,4-dinitrate is C(CO[N+](=O)[O-])C(CO[N+](=O)[O-])O.
How many hydrogen bond donor counts does 1,2,4-butanetriol-1,4-dinitrate have?
1,2,4-butanetriol-1,4-dinitrate has 1 hydrogen bond donor count.
How many hydrogen bond acceptor counts does 1,2,4-butanetriol-1,4-dinitrate have?
1,2,4-butanetriol-1,4-dinitrate has 7 hydrogen bond acceptor counts.
How many rotatable bond counts does 1,2,4-butanetriol-1,4-dinitrate have?
1,2,4-butanetriol-1,4-dinitrate has 5 rotatable bond counts.