What is the molecular formula of 1,2,4,5-Benzenetetrol?
The molecular formula of 1,2,4,5-Benzenetetrol is C6H6O4.
What are the synonyms for 1,2,4,5-Benzenetetrol?
The synonyms for 1,2,4,5-Benzenetetrol include benzene-1,2,4,5-tetraol, BENZENE-1,2,4,5-TETROL, and 1,2,4,5-tetrahydroxybenzene.
What is the molecular weight of 1,2,4,5-Benzenetetrol?
The molecular weight of 1,2,4,5-Benzenetetrol is 142.11 g/mol.
When was 1,2,4,5-Benzenetetrol created?
1,2,4,5-Benzenetetrol was created on March 26, 2005.
What is the IUPAC name of 1,2,4,5-Benzenetetrol?
The IUPAC name of 1,2,4,5-Benzenetetrol is benzene-1,2,4,5-tetrol.
What is the InChI of 1,2,4,5-Benzenetetrol?
The InChI of 1,2,4,5-Benzenetetrol is InChI=1S/C6H6O4/c7-3-1-4(8)6(10)2-5(3)9/h1-2,7-10H.
What is the InChIKey of 1,2,4,5-Benzenetetrol?
The InChIKey of 1,2,4,5-Benzenetetrol is UYQMSQMCIYSXOW-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,4,5-Benzenetetrol?
The canonical SMILES of 1,2,4,5-Benzenetetrol is C1=C(C(=CC(=C1O)O)O)O.
What is the CAS number of 1,2,4,5-Benzenetetrol?
The CAS number of 1,2,4,5-Benzenetetrol is 636-32-8.
What is the XLogP3-AA value of 1,2,4,5-Benzenetetrol?
The XLogP3-AA value of 1,2,4,5-Benzenetetrol is 0.5.