What is the molecular formula of 1,2,3-Trifluorobenzene?
The molecular formula of 1,2,3-Trifluorobenzene is C6H3F3.
What is the molecular weight of 1,2,3-Trifluorobenzene?
The molecular weight of 1,2,3-Trifluorobenzene is 132.08 g/mol.
What is the IUPAC name of 1,2,3-Trifluorobenzene?
The IUPAC name of 1,2,3-Trifluorobenzene is 1,2,3-trifluorobenzene.
What is the InChI of 1,2,3-Trifluorobenzene?
The InChI of 1,2,3-Trifluorobenzene is InChI=1S/C6H3F3/c7-4-2-1-3-5(8)6(4)9/h1-3H.
What is the InChIKey of 1,2,3-Trifluorobenzene?
The InChIKey of 1,2,3-Trifluorobenzene is AJKNNUJQFALRIK-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3-Trifluorobenzene?
The canonical SMILES of 1,2,3-Trifluorobenzene is C1=CC(=C(C(=C1)F)F)F.
What is the CAS number of 1,2,3-Trifluorobenzene?
The CAS number of 1,2,3-Trifluorobenzene is 1489-53-8.
What is the EC number of 1,2,3-Trifluorobenzene?
The EC number of 1,2,3-Trifluorobenzene is 625-446-9.
What is the XLogP3 value of 1,2,3-Trifluorobenzene?
The XLogP3 value of 1,2,3-Trifluorobenzene is 2.5.
Is 1,2,3-Trifluorobenzene a canonicalized compound?
Yes, 1,2,3-Trifluorobenzene is a canonicalized compound.