What is the molecular formula of 1,2,3,4,5-Pentamethylcyclopentadiene?
The molecular formula of 1,2,3,4,5-Pentamethylcyclopentadiene is C10H16.
What is the molecular weight of 1,2,3,4,5-Pentamethylcyclopentadiene?
The molecular weight of 1,2,3,4,5-Pentamethylcyclopentadiene is 136.23 g/mol.
What is the IUPAC name of 1,2,3,4,5-Pentamethylcyclopentadiene?
The IUPAC name of 1,2,3,4,5-Pentamethylcyclopentadiene is 1,2,3,4,5-pentamethylcyclopenta-1,3-diene.
What is the InChI of 1,2,3,4,5-Pentamethylcyclopentadiene?
The InChI of 1,2,3,4,5-Pentamethylcyclopentadiene is InChI=1S/C10H16/c1-6-7(2)9(4)10(5)8(6)3/h6H,1-5H3.
What is the InChIKey of 1,2,3,4,5-Pentamethylcyclopentadiene?
The InChIKey of 1,2,3,4,5-Pentamethylcyclopentadiene is WQIQNKQYEUMPBM-UHFFFAOYSA-N.
What is the canonical SMILES of 1,2,3,4,5-Pentamethylcyclopentadiene?
The canonical SMILES of 1,2,3,4,5-Pentamethylcyclopentadiene is CC1C(=C(C(=C1C)C)C)C.
What is the CAS number of 1,2,3,4,5-Pentamethylcyclopentadiene?
The CAS number of 1,2,3,4,5-Pentamethylcyclopentadiene is 4045-44-7.
What is the XLogP3-AA value of 1,2,3,4,5-Pentamethylcyclopentadiene?
The XLogP3-AA value of 1,2,3,4,5-Pentamethylcyclopentadiene is 1.9.
How many hydrogen bond donor counts does 1,2,3,4,5-Pentamethylcyclopentadiene have?
1,2,3,4,5-Pentamethylcyclopentadiene has 0 hydrogen bond donor count.
How many heavy atoms does 1,2,3,4,5-Pentamethylcyclopentadiene have?
1,2,3,4,5-Pentamethylcyclopentadiene has 10 heavy atoms.