What is the molecular formula of 1,1,3,3-Tetramethoxypropane?
The molecular formula of 1,1,3,3-Tetramethoxypropane is C7H16O4.
What is the molecular weight of 1,1,3,3-Tetramethoxypropane?
The molecular weight of 1,1,3,3-Tetramethoxypropane is 164.20 g/mol.
What is the IUPAC name of 1,1,3,3-Tetramethoxypropane?
The IUPAC name of 1,1,3,3-Tetramethoxypropane is 1,1,3,3-tetramethoxypropane.
What is the InChI of 1,1,3,3-Tetramethoxypropane?
The InChI of 1,1,3,3-Tetramethoxypropane is InChI=1S/C7H16O4/c1-8-6(9-2)5-7(10-3)11-4/h6-7H,5H2,1-4H3.
What is the InChIKey of 1,1,3,3-Tetramethoxypropane?
The InChIKey of 1,1,3,3-Tetramethoxypropane is XHTYQFMRBQUCPX-UHFFFAOYSA-N.
What is the canonical SMILES of 1,1,3,3-Tetramethoxypropane?
The canonical SMILES of 1,1,3,3-Tetramethoxypropane is COC(CC(OC)OC)OC.
What is the CAS number of 1,1,3,3-Tetramethoxypropane?
The CAS number of 1,1,3,3-Tetramethoxypropane is 102-52-3.
What is the European Community (EC) number of 1,1,3,3-Tetramethoxypropane?
The European Community (EC) number of 1,1,3,3-Tetramethoxypropane is 203-037-2.
What is the ChEMBL ID of 1,1,3,3-Tetramethoxypropane?
The ChEMBL ID of 1,1,3,3-Tetramethoxypropane is CHEMBL592723.
What is the monoisotopic mass of 1,1,3,3-Tetramethoxypropane?
The monoisotopic mass of 1,1,3,3-Tetramethoxypropane is 164.10485899 g/mol.